CAS 521298-46-4 is the registry number for SAL-0010042. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(2-fluorophenyl)methyl]-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one (CAS 521298-46-4) is a chemical compound with the molecular formula C15H15FN4O and a molecular weight of 286.30 g/mol. IUPAC name: 5-[(2-fluorophenyl)methyl]-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one. InChIKey: QWTNEJGXUCJWPY-UHFFFAOYSA-N.
| Molecular formula | C15H15FN4O |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | 5-[(2-fluorophenyl)methyl]-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| InChIKey | QWTNEJGXUCJWPY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=NN1)C(=O)NC(=N2)CC3=CC=CC=C3F |
Computed by PubChem (NCBI)