CAS 521300-04-9 is the registry number for N-(3-Acetamidophenyl)pivalamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-acetamidophenyl)-2,2-dimethylpropanamide (CAS 521300-04-9) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: N-(3-acetamidophenyl)-2,2-dimethylpropanamide. InChIKey: LHUOYQIWKGKBBY-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | N-(3-acetamidophenyl)-2,2-dimethylpropanamide |
| InChIKey | LHUOYQIWKGKBBY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)