CAS 5216-36-4 appears in our catalog under these names: 4,4'–Dicyanostilbene, 4,4'-(Ethyne-1,2-diyl)dibenzonitrile 98%, 4,4'-(Ethyne-1,2-diyl)dibenzonitrile, 98%, 98%, 4,4'-(Ethyne-1,2-diyl)dibenzonitrile, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
4-[(E)-2-(4-cyanophenyl)ethenyl]benzonitrile (CAS 5216-36-4) is a chemical compound with the molecular formula C16H10N2 and a molecular weight of 230.26 g/mol. IUPAC name: 4-[(E)-2-(4-cyanophenyl)ethenyl]benzonitrile. InChIKey: RNIZPDIBRXCMRD-OWOJBTEDSA-N.
| Molecular formula | C16H10N2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 4-[(E)-2-(4-cyanophenyl)ethenyl]benzonitrile |
| InChIKey | RNIZPDIBRXCMRD-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)