Products 54676-54-9
CAS 54676-54-9 is the registry number for (Z)-p-cyano-α-Cyanostilbene. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-1-cyano-2-phenylethenyl]benzonitrile (CAS 54676-54-9) is a chemical compound with the molecular formula C16H10N2 and a molecular weight of 230.26 g/mol. IUPAC name: 4-[(E)-1-cyano-2-phenylethenyl]benzonitrile. InChIKey: XDDAUUXKEGNGIY-YBEGLDIGSA-N.
| Molecular formula | C16H10N2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 4-[(E)-1-cyano-2-phenylethenyl]benzonitrile |
| InChIKey | XDDAUUXKEGNGIY-YBEGLDIGSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C#N)\C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)