CAS 52314-67-7 appears in our catalog under these names: 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride, 95%, 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl Chloride. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 5g, 500mg.
3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride (CAS 52314-67-7) is a chemical compound with the molecular formula C8H9Cl3O and a molecular weight of 227.5 g/mol. IUPAC name: 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride. InChIKey: CHLAOFANYRDCPD-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3O |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
| InChIKey | CHLAOFANYRDCPD-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)Cl)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)