CAS 61914-47-4 is the registry number for (1R)-trans-Permethroyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
Cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride (CAS 61914-47-4) is a chemical compound with the molecular formula C8H9Cl3O and a molecular weight of 227.5 g/mol. IUPAC name: cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride. InChIKey: CHLAOFANYRDCPD-XINAWCOVSA-N.
| Molecular formula | C8H9Cl3O |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
| InChIKey | CHLAOFANYRDCPD-XINAWCOVSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)Cl)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)