CAS 52381-06-3 is the registry number for 2,5-Dimethyl-3-nitropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,5-dimethyl-3-nitropyridine (CAS 52381-06-3) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2,5-dimethyl-3-nitropyridine. InChIKey: ODTIWFKSSFPXNI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2,5-dimethyl-3-nitropyridine |
| InChIKey | ODTIWFKSSFPXNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)