Products 524-90-3
CAS 524-90-3 is the registry number for Evolatine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4,6-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutane-2,3-diol (CAS 524-90-3) is a chemical compound with the molecular formula C18H21NO6 and a molecular weight of 347.4 g/mol. IUPAC name: 1-(4,6-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutane-2,3-diol. InChIKey: FDFXOWJHWJKKRT-UHFFFAOYSA-N.
| Molecular formula | C18H21NO6 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-(4,6-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutane-2,3-diol |
| InChIKey | FDFXOWJHWJKKRT-UHFFFAOYSA-N |
| SMILES | CC(C)(C(COC1=C(C=C2C(=C1)N=C3C(=C2OC)C=CO3)OC)O)O |
Computed by PubChem (NCBI)