CAS 52411-49-1 appears in our catalog under these names: 3-(Chloromethyl)-2,4,6-trimethylbenzoic Acid, >95% (HPLC), 3-(Chloromethyl)-2,4,6-trimethylbenzoic acid 97%, 3-(Chloromethyl)-2,4,6-trimethylbenzoic acid, 97%, 97%, BENZOIC ACID, 3-(CHLOROMETHYL)-2,4,6-TRIMETHYL-, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 1g.
3-(chloromethyl)-2,4,6-trimethylbenzoic acid (CAS 52411-49-1) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: 3-(chloromethyl)-2,4,6-trimethylbenzoic acid. InChIKey: HCXGMDXQWGQHGE-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-(chloromethyl)-2,4,6-trimethylbenzoic acid |
| InChIKey | HCXGMDXQWGQHGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CCl)C)C(=O)O)C |
Computed by PubChem (NCBI)