CAS 52465-59-5 appears in our catalog under these names: 2,3,6–Trichloro–5–(chloromethyl)pyridine, 2,3,6-Trichloro-5-(chloromethyl)pyridine 95%, 2,3,6-TRICHLORO-5-(CHLOROMETHYL)PYRIDINE, 95%, 2,3,6-Trichloro-5-(chloromethyl)pyridine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3,6-trichloro-5-(chloromethyl)pyridine (CAS 52465-59-5) is a chemical compound with the molecular formula C6H3Cl4N and a molecular weight of 230.9 g/mol. IUPAC name: 2,3,6-trichloro-5-(chloromethyl)pyridine. InChIKey: DGRWKOIUYLWSEV-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl4N |
|---|---|
| Molecular weight | 230.9 g/mol |
| IUPAC name | 2,3,6-trichloro-5-(chloromethyl)pyridine |
| InChIKey | DGRWKOIUYLWSEV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)Cl)CCl |
Computed by PubChem (NCBI)