CAS 654-36-4 appears in our catalog under these names: 2,3,4,6-Tetrachloroaniline 95%, 2,3,4,6-Tetrachloroaniline, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3,4,6-tetrachloroaniline (CAS 654-36-4) is a chemical compound with the molecular formula C6H3Cl4N and a molecular weight of 230.9 g/mol. IUPAC name: 2,3,4,6-tetrachloroaniline. InChIKey: LXCLPHJRGDTDDB-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl4N |
|---|---|
| Molecular weight | 230.9 g/mol |
| IUPAC name | 2,3,4,6-tetrachloroaniline |
| InChIKey | LXCLPHJRGDTDDB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)N)Cl |
Computed by PubChem (NCBI)