Products 60348-32-5
CAS 60348-32-5 is the registry number for N-(Chloroacetyl)-N-(2-ethyl-6-methylphenyl)-L-alanine Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Methyl (2S)-2-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propanoate (CAS 60348-32-5) is a chemical compound with the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. IUPAC name: methyl (2S)-2-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propanoate. InChIKey: VVYRNQHQSPNZNB-NSHDSACASA-N.
| Molecular formula | C15H20ClNO3 |
|---|---|
| Molecular weight | 297.78 g/mol |
| IUPAC name | methyl (2S)-2-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propanoate |
| InChIKey | VVYRNQHQSPNZNB-NSHDSACASA-N |
| SMILES | CCC1=CC=CC(=C1N([C@@H](C)C(=O)OC)C(=O)CCl)C |
Computed by PubChem (NCBI)