CAS 5247-85-8 is the registry number for 2H-Naphtho(1,8-bc)furan-2-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one (CAS 5247-85-8) is a chemical compound with the molecular formula C11H6O2 and a molecular weight of 170.16 g/mol. IUPAC name: 2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one. InChIKey: QGYVYNJHKNNLFL-UHFFFAOYSA-N.
| Molecular formula | C11H6O2 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
| InChIKey | QGYVYNJHKNNLFL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)OC3=CC=C2 |
Computed by PubChem (NCBI)