CAS 883106-26-1 appears in our catalog under these names: 3,5-Diethynylbenzoic acid, 95%, 3,5–Diethynylbenzoic acid, 3,5-Diethynylbenzoic acid 95%, 3,5-Diethynylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3,5-diethynylbenzoic acid (CAS 883106-26-1) is a chemical compound with the molecular formula C11H6O2 and a molecular weight of 170.16 g/mol. IUPAC name: 3,5-diethynylbenzoic acid. InChIKey: KUZBIUTZPWIHSI-UHFFFAOYSA-N.
| Molecular formula | C11H6O2 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 3,5-diethynylbenzoic acid |
| InChIKey | KUZBIUTZPWIHSI-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC(=C1)C(=O)O)C#C |
Computed by PubChem (NCBI)