Products 52548-96-6

CAS 52548-96-6 is the registry number for 2-Carboxy-4-(trifluoromethyl)diphenylsulphide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-phenylsulfanyl-5-(trifluoromethyl)benzoic acid (CAS 52548-96-6) is a chemical compound with the molecular formula C14H9F3O2S and a molecular weight of 298.28 g/mol. IUPAC name: 2-phenylsulfanyl-5-(trifluoromethyl)benzoic acid. InChIKey: QTOLCTUWRPDFOF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9F3O2S
Molecular weight298.28 g/mol
IUPAC name2-phenylsulfanyl-5-(trifluoromethyl)benzoic acid
InChIKeyQTOLCTUWRPDFOF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)SC2=C(C=C(C=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)