CAS 52548-96-6 is the registry number for 2-Carboxy-4-(trifluoromethyl)diphenylsulphide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-phenylsulfanyl-5-(trifluoromethyl)benzoic acid (CAS 52548-96-6) is a chemical compound with the molecular formula C14H9F3O2S and a molecular weight of 298.28 g/mol. IUPAC name: 2-phenylsulfanyl-5-(trifluoromethyl)benzoic acid. InChIKey: QTOLCTUWRPDFOF-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2S |
|---|---|
| Molecular weight | 298.28 g/mol |
| IUPAC name | 2-phenylsulfanyl-5-(trifluoromethyl)benzoic acid |
| InChIKey | QTOLCTUWRPDFOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)