CAS 895-45-4 appears in our catalog under these names: 2–(4'–TrifluoroMethylphenylthio)benzoic acid, 2-[[4-(Trifluoromethyl)phenyl]thio]benzoic acid, 99%, 99%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
2-[4-(trifluoromethyl)phenyl]sulfanylbenzoic acid (CAS 895-45-4) is a chemical compound with the molecular formula C14H9F3O2S and a molecular weight of 298.28 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]sulfanylbenzoic acid. InChIKey: CXYQQXOGXPPFGM-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2S |
|---|---|
| Molecular weight | 298.28 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]sulfanylbenzoic acid |
| InChIKey | CXYQQXOGXPPFGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)