CAS 5257-08-9 is the registry number for Glycozolinine. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methyl-9H-carbazol-3-ol (CAS 5257-08-9) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 6-methyl-9H-carbazol-3-ol. InChIKey: HGWWJXCROVKODY-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 6-methyl-9H-carbazol-3-ol |
| InChIKey | HGWWJXCROVKODY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2C=C(C=C3)O |
Computed by PubChem (NCBI)