CAS 52649-03-3 is the registry number for Ethyl 4-ethynyl-3,5-dimethyl-1H-pyrrole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-ethynyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CAS 52649-03-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: ethyl 4-ethynyl-3,5-dimethyl-1H-pyrrole-2-carboxylate. InChIKey: ACJNBQSTNRQMAF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | ethyl 4-ethynyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | ACJNBQSTNRQMAF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)C)C#C)C |
Computed by PubChem (NCBI)