CAS 52663-71-5 appears in our catalog under these names: 2,2',3,3',4,4',6-Heptachlorobiphenyl, >95% (HPLC), PCB No. 171 10 µg/mL in Isooctane, PCB 171, ROTI®Star, 5 mg, glass. Offered by: TRC, Dr. Ehrenstorfer, Roth. Available pack sizes: 10mg, 1mg, 10ml, 5mg.
1,2,3,5-tetrachloro-4-(2,3,4-trichlorophenyl)benzene (CAS 52663-71-5) is a chemical compound with the molecular formula C12H3Cl7 and a molecular weight of 395.3 g/mol. IUPAC name: 1,2,3,5-tetrachloro-4-(2,3,4-trichlorophenyl)benzene. InChIKey: TZMHVHLTPWKZCI-UHFFFAOYSA-N.
| Molecular formula | C12H3Cl7 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1,2,3,5-tetrachloro-4-(2,3,4-trichlorophenyl)benzene |
| InChIKey | TZMHVHLTPWKZCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=C(C(=C(C=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)