CAS 52663-74-8 is the registry number for 2,2',3,3',4,5,5'-Heptachlorobiphenyl. Offered by: TRC. Available pack sizes: 10mg.
1,2,3,4-tetrachloro-5-(2,3,5-trichlorophenyl)benzene (CAS 52663-74-8) is a chemical compound with the molecular formula C12H3Cl7 and a molecular weight of 395.3 g/mol. IUPAC name: 1,2,3,4-tetrachloro-5-(2,3,5-trichlorophenyl)benzene. InChIKey: HOPMUCXYRNOABF-UHFFFAOYSA-N.
| Molecular formula | C12H3Cl7 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5-(2,3,5-trichlorophenyl)benzene |
| InChIKey | HOPMUCXYRNOABF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C2=CC(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)