CAS 5267-53-8 is the registry number for Naphthalen-1-yl(phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 10g.
Naphthalen-1-yl(phenyl)methanamine;hydrochloride (CAS 5267-53-8) is a chemical compound with the molecular formula C17H16ClN and a molecular weight of 269.8 g/mol. IUPAC name: naphthalen-1-yl(phenyl)methanamine;hydrochloride. InChIKey: AAKZJNSNWIKDKI-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN |
|---|---|
| Molecular weight | 269.8 g/mol |
| IUPAC name | naphthalen-1-yl(phenyl)methanamine;hydrochloride |
| InChIKey | AAKZJNSNWIKDKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC3=CC=CC=C32)N.Cl |
Computed by PubChem (NCBI)