Products 5270-49-5

CAS 5270-49-5 appears in our catalog under these names: 2,8-Dioxaspiro(4.5)decane-1,3-dione, 97%, 2,8-Dioxaspiro(4.5)decane-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 50mg, 0,5g.

2,8-dioxaspiro[4.5]decane-1,3-dione (CAS 5270-49-5) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 2,8-dioxaspiro[4.5]decane-1,3-dione. InChIKey: BPLDSHSHEFQZPP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4
Molecular weight170.16 g/mol
IUPAC name2,8-dioxaspiro[4.5]decane-1,3-dione
InChIKeyBPLDSHSHEFQZPP-UHFFFAOYSA-N
SMILESC1COCCC12CC(=O)OC2=O

Computed by PubChem (NCBI)