CAS 52715-93-2 appears in our catalog under these names: DL-Methionyl-DL-methionine, >95% (HPLC), DL–Methionyl–DL–methionine, Methionyl-methionine, Methionylmethionine HCl (Mixture of Diastereomers). Offered by: TRC, GLPBio, MedChemExpress, Chemat Brand. Available pack sizes: 100mg, 1g, 5g, 50mg, 1 g, 5 g, 100 mg, 50 mg.
2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylsulfanylbutanoic acid (CAS 52715-93-2) is a chemical compound with the molecular formula C10H20N2O3S2 and a molecular weight of 280.4 g/mol. IUPAC name: 2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylsulfanylbutanoic acid. InChIKey: ZYTPOUNUXRBYGW-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O3S2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylsulfanylbutanoic acid |
| InChIKey | ZYTPOUNUXRBYGW-UHFFFAOYSA-N |
| SMILES | CSCCC(C(=O)NC(CCSC)C(=O)O)N |
Computed by PubChem (NCBI)