CAS 7349-78-2 appears in our catalog under these names: (S)-2-((S)-2-Amino-4-(methylthio)butanamido)-4-(methylthio)butanoic acid, 95%, 95%, H-Met-Met-OH, 98%, H–Met–Met–OH, H-Met-Met-OH, Met-Met. Offered by: Chemat, AmBeed, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 50mg, 0,1g, 500mg.
(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid (CAS 7349-78-2) is a chemical compound with the molecular formula C10H20N2O3S2 and a molecular weight of 280.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: ZYTPOUNUXRBYGW-YUMQZZPRSA-N.
| Molecular formula | C10H20N2O3S2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| InChIKey | ZYTPOUNUXRBYGW-YUMQZZPRSA-N |
| SMILES | CSCC[C@@H](C(=O)N[C@@H](CCSC)C(=O)O)N |
Computed by PubChem (NCBI)