CAS 52721-77-4 appears in our catalog under these names: N-Formyl-4-iodo-l-phenylalanine, 96%, (S)-2-Formamido-3-(4-iodophenyl)propanoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 1g, 5g.
(2S)-2-formamido-3-(4-iodophenyl)propanoic acid (CAS 52721-77-4) is a chemical compound with the molecular formula C10H10INO3 and a molecular weight of 319.10 g/mol. IUPAC name: (2S)-2-formamido-3-(4-iodophenyl)propanoic acid. InChIKey: FCLBWSIAKJLFMP-VIFPVBQESA-N.
| Molecular formula | C10H10INO3 |
|---|---|
| Molecular weight | 319.10 g/mol |
| IUPAC name | (2S)-2-formamido-3-(4-iodophenyl)propanoic acid |
| InChIKey | FCLBWSIAKJLFMP-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC=O)I |
Computed by PubChem (NCBI)