Products 73721-75-2

CAS 73721-75-2 is the registry number for 5-Iodo-2-propionamidobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-iodo-2-(propanoylamino)benzoic acid (CAS 73721-75-2) is a chemical compound with the molecular formula C10H10INO3 and a molecular weight of 319.10 g/mol. IUPAC name: 5-iodo-2-(propanoylamino)benzoic acid. InChIKey: KLDKRNWQLNPQMK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10INO3
Molecular weight319.10 g/mol
IUPAC name5-iodo-2-(propanoylamino)benzoic acid
InChIKeyKLDKRNWQLNPQMK-UHFFFAOYSA-N
SMILESCCC(=O)NC1=C(C=C(C=C1)I)C(=O)O

Computed by PubChem (NCBI)