CAS 527680-57-5 appears in our catalog under these names: PHA 568487, 98%, PHA 568487, PHA 568487, ≥99%(HPLC), ≥99%(HPLC). Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 10mg, 50mg, 5mg, 25mg, 100mg, Get quote.
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide;(E)-but-2-enedioic acid (CAS 527680-57-5) is a chemical compound with the molecular formula C20H24N2O7 and a molecular weight of 404.4 g/mol. IUPAC name: N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide;(E)-but-2-enedioic acid. InChIKey: QYQZUGYJVHHHEE-QDSMGTAFSA-N.
| Molecular formula | C20H24N2O7 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide;(E)-but-2-enedioic acid |
| InChIKey | QYQZUGYJVHHHEE-QDSMGTAFSA-N |
| SMILES | C1CN2CCC1[C@H](C2)NC(=O)C3=CC4=C(C=C3)OCCO4.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)