CAS 82219-47-4 appears in our catalog under these names: Nimodipine Impurity 34, Nimodipine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-(2-hydroxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 82219-47-4) is a chemical compound with the molecular formula C20H24N2O7 and a molecular weight of 404.4 g/mol. IUPAC name: 3-O-(2-hydroxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: RNXRFRBWBFBZCQ-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O7 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 3-O-(2-hydroxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | RNXRFRBWBFBZCQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCO |
Computed by PubChem (NCBI)