CAS 52783-75-2 appears in our catalog under these names: 1-Bromo-5-(chloromethyl)-2,3-dimethoxybenzene, 95%, 1-Bromo-5-(chloromethyl)-2,3-dimethoxybenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
1-bromo-5-(chloromethyl)-2,3-dimethoxybenzene (CAS 52783-75-2) is a chemical compound with the molecular formula C9H10BrClO2 and a molecular weight of 265.53 g/mol. IUPAC name: 1-bromo-5-(chloromethyl)-2,3-dimethoxybenzene. InChIKey: KXEFZWNRTCPMOU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO2 |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 1-bromo-5-(chloromethyl)-2,3-dimethoxybenzene |
| InChIKey | KXEFZWNRTCPMOU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CCl)Br)OC |
Computed by PubChem (NCBI)