CAS 52816-63-4 is the registry number for 3-Acetyl-1,6-naphthyridin-2(1H)-one, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
3-acetyl-1H-1,6-naphthyridin-2-one (CAS 52816-63-4) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 3-acetyl-1H-1,6-naphthyridin-2-one. InChIKey: KFVXSMTUTDPPFM-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-acetyl-1H-1,6-naphthyridin-2-one |
| InChIKey | KFVXSMTUTDPPFM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=CN=C2)NC1=O |
Computed by PubChem (NCBI)