CAS 528531-45-5 is the registry number for N-(4-((4-(diphenylmethyl)piperazinyl)sulfonyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]acetamide (CAS 528531-45-5) is a chemical compound with the molecular formula C25H27N3O3S and a molecular weight of 449.6 g/mol. IUPAC name: N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]acetamide. InChIKey: QKNZYNUXHZUADG-UHFFFAOYSA-N.
| Molecular formula | C25H27N3O3S |
|---|---|
| Molecular weight | 449.6 g/mol |
| IUPAC name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]acetamide |
| InChIKey | QKNZYNUXHZUADG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)