CAS 52864-55-8 appears in our catalog under these names: Ethyl 2-(2-bromo-4-chlorophenyl)acetate, 95%, Ethyl 2-(2-bromo-4-chlorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 2-(2-bromo-4-chlorophenyl)acetate (CAS 52864-55-8) is a chemical compound with the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. IUPAC name: ethyl 2-(2-bromo-4-chlorophenyl)acetate. InChIKey: JICLXILCAYHCAW-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO2 |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | ethyl 2-(2-bromo-4-chlorophenyl)acetate |
| InChIKey | JICLXILCAYHCAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)