CAS 529475-87-4 is the registry number for 1-(4-Chlorophenyl)-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorophenyl)-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 529475-87-4) is a chemical compound with the molecular formula C18H17ClN2 and a molecular weight of 296.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: MYDMZCBPIPOOQR-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN2 |
|---|---|
| Molecular weight | 296.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | MYDMZCBPIPOOQR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CCNC3C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)