Products 905811-70-3
CAS 905811-70-3 is the registry number for 4-(Chloromethyl)-3-(3,4-dimethylphenyl)-1-phenyl-1H-pyrazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(chloromethyl)-3-(3,4-dimethylphenyl)-1-phenylpyrazole (CAS 905811-70-3) is a chemical compound with the molecular formula C18H17ClN2 and a molecular weight of 296.8 g/mol. IUPAC name: 4-(chloromethyl)-3-(3,4-dimethylphenyl)-1-phenylpyrazole. InChIKey: MXTGNJBFKJRMJG-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN2 |
|---|---|
| Molecular weight | 296.8 g/mol |
| IUPAC name | 4-(chloromethyl)-3-(3,4-dimethylphenyl)-1-phenylpyrazole |
| InChIKey | MXTGNJBFKJRMJG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN(C=C2CCl)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)