CAS 529508-58-5 appears in our catalog under these names: 1–(3–Fluorobenzyl)–5–nitro–1H–indazole, 1-(3-Fluorobenzyl)-5-nitro-1H-indazole, 95%, 95%, 1-(3-Fluorobenzyl)-5-nitro-1H-indazole, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
1-[(3-fluorophenyl)methyl]-5-nitroindazole (CAS 529508-58-5) is a chemical compound with the molecular formula C14H10FN3O2 and a molecular weight of 271.25 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]-5-nitroindazole. InChIKey: FMBVHKPWDJQLNO-UHFFFAOYSA-N.
| Molecular formula | C14H10FN3O2 |
|---|---|
| Molecular weight | 271.25 g/mol |
| IUPAC name | 1-[(3-fluorophenyl)methyl]-5-nitroindazole |
| InChIKey | FMBVHKPWDJQLNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CN2C3=C(C=C(C=C3)[N+](=O)[O-])C=N2 |
Computed by PubChem (NCBI)