CAS 52979-91-6 is the registry number for 7,8-Dimethyl-4-oxo-1,4-dihydro-2-quinolinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7,8-dimethyl-4-oxo-1H-quinoline-2-carboxylic acid (CAS 52979-91-6) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 7,8-dimethyl-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: WQYUWRVKNBTRGO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 7,8-dimethyl-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | WQYUWRVKNBTRGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C=C(N2)C(=O)O)C |
Computed by PubChem (NCBI)