CAS 530-50-7 appears in our catalog under these names: 1,1-Diphenylhydrazine, 97%, 1,1-Diphenylhydrazine, >97.0%(GC)(T). Offered by: Combi-blocks, TCI. Available pack sizes: 1g, 5g, 5ml.
1,1-diphenylhydrazine (CAS 530-50-7) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 1,1-diphenylhydrazine. InChIKey: YHYKLKNNBYLTQY-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 1,1-diphenylhydrazine |
| InChIKey | YHYKLKNNBYLTQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N |
Computed by PubChem (NCBI)