Products 53017-51-9

CAS 53017-51-9 is the registry number for N-α-Acetyl-5-benzyloxy-DL-tryptophan. Offered by: Biosynth. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

2-acetamido-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid (CAS 53017-51-9) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: 2-acetamido-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid. InChIKey: JOYGSMRGJUMINJ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20N2O4
Molecular weight352.4 g/mol
IUPAC name2-acetamido-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid
InChIKeyJOYGSMRGJUMINJ-UHFFFAOYSA-N
SMILESCC(=O)NC(CC1=CNC2=C1C=C(C=C2)OCC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)