CAS 5306-42-3 is the registry number for 2-Methoxy-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-methoxy-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline (CAS 5306-42-3) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 2-methoxy-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: HUGVMNXPVROVGY-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-methoxy-5-(5-methyl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | HUGVMNXPVROVGY-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC(=C(C=C2)OC)N |
Computed by PubChem (NCBI)