CAS 53108-00-2 appears in our catalog under these names: (Rac)-Methylindazone, 98%, (Rac)-Methylindazone. Offered by: AmBeed, MedChemExpress. Available pack sizes: 250mg, 1g, Get quote.
2-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]acetic acid (CAS 53108-00-2) is a chemical compound with the molecular formula C17H18Cl2O4 and a molecular weight of 357.2 g/mol. IUPAC name: 2-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]acetic acid. InChIKey: RNOJGTHBMJBOSP-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2O4 |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 2-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]acetic acid |
| InChIKey | RNOJGTHBMJBOSP-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC(=C(C(=C2C1=O)Cl)Cl)OCC(=O)O)C3CCCC3 |
Computed by PubChem (NCBI)