Products 53130-45-3
CAS 53130-45-3 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)benzamide, 97%, 2,4-bis(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
2,4-bis(trifluoromethyl)benzamide (CAS 53130-45-3) is a chemical compound with the molecular formula C9H5F6NO and a molecular weight of 257.13 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)benzamide. InChIKey: UFXIIQGMMJQZPG-UHFFFAOYSA-N.
| Molecular formula | C9H5F6NO |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 2,4-bis(trifluoromethyl)benzamide |
| InChIKey | UFXIIQGMMJQZPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)