Products 959055-29-9
CAS 959055-29-9 is the registry number for 2,2,3,3,3-Pentafluoro-N-(3,4,5-trifluorophenyl)propenamide . Offered by: TRC. Available pack sizes: 10g.
2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide (CAS 959055-29-9) is a chemical compound with the molecular formula C9H5F6NO and a molecular weight of 257.13 g/mol. IUPAC name: 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide. InChIKey: PBUZXWZWAZFUOL-UHFFFAOYSA-N.
| Molecular formula | C9H5F6NO |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)propanamide |
| InChIKey | PBUZXWZWAZFUOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)