Products 531536-55-7

CAS 531536-55-7 is the registry number for [(1-Cyclopentyl-1h-tetrazol-5-yl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(1-cyclopentyltetrazol-5-yl)sulfanylacetic acid (CAS 531536-55-7) is a chemical compound with the molecular formula C8H12N4O2S and a molecular weight of 228.27 g/mol. IUPAC name: 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetic acid. InChIKey: QPWCCVDBCKPKPV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N4O2S
Molecular weight228.27 g/mol
IUPAC name2-(1-cyclopentyltetrazol-5-yl)sulfanylacetic acid
InChIKeyQPWCCVDBCKPKPV-UHFFFAOYSA-N
SMILESC1CCC(C1)N2C(=NN=N2)SCC(=O)O

Computed by PubChem (NCBI)