CAS 7185-65-1 is the registry number for Ethyl 2-guanidino-4-methylthiazole-5-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxylate (CAS 7185-65-1) is a chemical compound with the molecular formula C8H12N4O2S and a molecular weight of 228.27 g/mol. IUPAC name: ethyl 2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: HYYMOZMJVDQRAO-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O2S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | ethyl 2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | HYYMOZMJVDQRAO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N=C(N)N)C |
Computed by PubChem (NCBI)