CAS 53164-96-8 is the registry number for 4-(4-Methylpyridin-3-yl)phenol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4-methyl-3-pyridinyl)phenol (CAS 53164-96-8) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 4-(4-methyl-3-pyridinyl)phenol. InChIKey: OHKVMBRWSSRDAP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-(4-methyl-3-pyridinyl)phenol |
| InChIKey | OHKVMBRWSSRDAP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)