Products 5324-67-4

CAS 5324-67-4 is the registry number for 3-Methanesulfonyl-2,2-dimethylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,2-dimethyl-3-methylsulfonylpropanoic acid (CAS 5324-67-4) is a chemical compound with the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. IUPAC name: 2,2-dimethyl-3-methylsulfonylpropanoic acid. InChIKey: FHYVGPXHEONOBH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12O4S
Molecular weight180.22 g/mol
IUPAC name2,2-dimethyl-3-methylsulfonylpropanoic acid
InChIKeyFHYVGPXHEONOBH-UHFFFAOYSA-N
SMILESCC(C)(CS(=O)(=O)C)C(=O)O

Computed by PubChem (NCBI)