Products 53326-93-5

CAS 53326-93-5 is the registry number for 1,2,3,4-Tetrahydro-7,8-dimethylphenazine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

7,8-dimethyl-1,2,3,4-tetrahydrophenazine (CAS 53326-93-5) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 7,8-dimethyl-1,2,3,4-tetrahydrophenazine. InChIKey: CBFFSAVMOPHWIR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2
Molecular weight212.29 g/mol
IUPAC name7,8-dimethyl-1,2,3,4-tetrahydrophenazine
InChIKeyCBFFSAVMOPHWIR-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C)N=C3CCCCC3=N2

Computed by PubChem (NCBI)