Products 53330-02-2
CAS 53330-02-2 is the registry number for S-(N-PhenethylthiocarbaMoyl)-L-cysteine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-amino-3-(2-phenylethylcarbamothioylsulfanyl)propanoic acid (CAS 53330-02-2) is a chemical compound with the molecular formula C12H16N2O2S2 and a molecular weight of 284.4 g/mol. IUPAC name: (2R)-2-amino-3-(2-phenylethylcarbamothioylsulfanyl)propanoic acid. InChIKey: FWNOABWJBHBVKJ-JTQLQIEISA-N.
| Molecular formula | C12H16N2O2S2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-phenylethylcarbamothioylsulfanyl)propanoic acid |
| InChIKey | FWNOABWJBHBVKJ-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=S)SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)