CAS 878218-43-0 is the registry number for N,N-Diethyl-3-isothiocyanato-4-methylbenzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N,N-diethyl-3-isothiocyanato-4-methylbenzenesulfonamide (CAS 878218-43-0) is a chemical compound with the molecular formula C12H16N2O2S2 and a molecular weight of 284.4 g/mol. IUPAC name: N,N-diethyl-3-isothiocyanato-4-methylbenzenesulfonamide. InChIKey: JOVGKZWHXZOCKO-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2S2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | N,N-diethyl-3-isothiocyanato-4-methylbenzenesulfonamide |
| InChIKey | JOVGKZWHXZOCKO-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)C)N=C=S |
Computed by PubChem (NCBI)