CAS 53348-92-8 is the registry number for 4-Aminocoumarin, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg.
4-aminochromen-2-one (CAS 53348-92-8) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 4-aminochromen-2-one. InChIKey: AHZAKFLOHIRCDU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-aminochromen-2-one |
| InChIKey | AHZAKFLOHIRCDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)O2)N |
Computed by PubChem (NCBI)